Tính chất: EP
Thương hiệu: Angene
| CAS Number | 129-73-7 |
| Catalog Number | AG0080FC(AGN-PC-00UN3G) |
| Chemical Name | Benzenamine,4,4'-(phenylmethylene)bis[N,N-dimethyl- |
| EC Number | 204-961-9 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]-phenylmethyl]-N,N-dimethylaniline |
| InChI | InChI=1S/C23H26N2/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4/h5-17,23H,1-4H3 |
| InChI Key | WZKXBGJNNCGHIC-UHFFFAOYSA-N |
| MDL Number | MFCD00008315 |
| Molecular Formula | C23H26N2 |
| Molecular Weight | 330.4659 |
| NSC Number | 36379 |
| SMILES | CN(c1ccc(cc1)C(c1ccc(cc1)N(C)C)c1ccccc1)C |
| UNII | 8U61G37Z20 |
| Synonyms |
4,4'-benzylidenebis(N,N-dimethylaniline), leucomalachite green, Leucomalachite green, 129-73-7, Leuco malachite green, Malachite green leuco, Malachite green leuco base, 4,4'-Bis(dimethylamino)triphenylmethane, Tetramethyldiaminotriphenylmethane, C.I. Basic Green 4, leuco base, Bis(p-dimethylaminophenyl)phenylmethane, p,p'-Benzylidenebis(N,N-dimethylaniline), NSC 36379, N,N,N',N'-Tetramethyl-4,4'-benzylidenedianiline, UNII-8U61G37Z20, 4,4'-benzylidenebis(N,N-dimethylaniline), Benzenamine,4,4'-(phenylmethylene)bis[N,N-dimethyl-, 4,4'-Benzylidene bis(N,N-dimethylaniline), Benzenamine, 4,4'-(phenylmethylene)bis[N,N-dimethyl-, Aniline, 4,4'-benzylidenebis(N,N-dimethyl-, Bis(p-(N,N-dimethylamino)phenyl)phenylmethane, Bis(4,4'-(dimethylamino)phenyl)phenyl methane, EINECS 204-961-9, 4,4'-Bis(N,N-dimethylaminophenyl)phenylmethane, MFCD00008315, 4,4'-(phenylmethylene)bis(N,N-dimethylaniline), BRN 2140506, AI3-22125, WZKXBGJNNCGHIC-UHFFFAOYSA-N, C23H26N2, 4,4'-(Phenylmethylene)bis(N,N-dimethylbenzenamine), Benzenamine, 4,4'-(phenylmethylene)bis(N,N-dimethyl-, 8U61G37Z20, Leucomalachite Green, pure, W-109477, Bis[p-(N,N-dimethylamino)phenyl]phenylmethane, Bis[4,4'-(dimethylamino)phenyl]phenyl methane, (4-{[4-(dimethylamino)phenyl]phenylmethyl}phenyl)dimethylamine, 4-[[4-(dimethylamino)phenyl]-phenylmethyl]-N,N-dimethylaniline, CCRIS 8665, HSDB 8047, 3btc, 3btl, LeucoMalachiteGreen, p,N-dimethylaniline), DSSTox_CID_11531, DSSTox_RID_78883, DSSTox_GSID_31531, SCHEMBL61350, 4-13-00-00481 (Beilstein Handbook Reference), AC1L272Z, CHEMBL1898627, DTXSID7031531, CTK4B6386, NSC36379, ZINC4272012, Tox21_302103, 4,N-dimethylaminophenyl)phenylmethane, 6664AF, ANW-42425, GT7606, LS-722, NSC-36379, SBB057320, AKOS015903777, 4,4'-Tetramethyldiaminotriphenylmethane, RTR-004088, KS-0000123H, p,p -Benzylidenebis-N,N-dimethylaniline, p,p'-Benzylidenebis-N,N-dimethylaniline, Aniline,4'-benzylidenebis[N,N-dimethyl-, Leucomalachite Green, analytical standard, NCGC00164047-01, NCGC00255258-01, AS-10441, CAS-129-73-7, SC-73571, p,p'-Benzylidene bis(N,N-dimethylaniline), TR-004088, B0419, FT-0631756, ST50307379, Leucomalachite green 10 microg/mL in Cyclohexane, Benzenamine,4'-(phenylmethylene)bis[N,N-dimethyl-, C-31375, Aniline, 4,4'-benzylidenebis(N,N-dimethyl- (8CI), I14-18018, LEUCOMALACHITE GREEN (MALACHITE GREEN CHLORIDE), 4-[(4-dimethylaminophenyl)-phenylmethyl]-N,N-dimethylaniline, 4-{[4-(dimethylamino)phenyl](phenyl)methyl}-N,N-dimethylaniline, Leucomalachite Green, certified reference material, TraceCERT(R), N-(4-[[4-(Dimethylamino)phenyl](phenyl)methyl]phenyl)-N,N-dimethylamine #, 4,N-dimethylaniline], MALACHITE GREEN, CID67215, C23-H26-N2, C015320, MGR, |
| Complexity | 342 |
| Compound Is Canonicalized | Yes |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 330.21g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 25 |
| Hydrogen Bond Acceptor Count | 2 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Molecular Weight | 330.475g/mol |
| Monoisotopic Mass | 330.21g/mol |
| Rotatable Bond Count | 5 |
| Topological Polar Surface Area | 6.5A^2 |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| XLogP3 | 5.3 |
GHS Hazard and Precautionary Statements
| Symbol: | |
| Hazard statements | H341-H351 |
| Precuationary statements | P201-P308+P313 |
| Siginal words |